C25H19ClN2O — CID 140647213
(E)-N-chloro-6'-(3-isocyanophenyl)spiro[3,5-dihydro-2H-1-benzoxepine-4,2'-3H-indene]-1'-imine (PubChem CID 140647213) has the molecular formula C25H19ClN2O and a molecular weight of 398.89 g/mol. Its IUPAC name is (E)-N-chloro-6'-(3-isocyanophenyl)spiro[3,5-dihydro-2H-1-benzoxepine-4,2'-3H-indene]-1'-imine.
| Compound Name | (E)-N-chloro-6'-(3-isocyanophenyl)spiro[3,5-dihydro-2H-1-benzoxepine-4,2'-3H-indene]-1'-imine |
|---|---|
| PubChem CID | 140647213 |
| Molecular Formula | C25H19ClN2O |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (E)-N-chloro-6'-(3-isocyanophenyl)spiro[3,5-dihydro-2H-1-benzoxepine-4,2'-3H-indene]-1'-imine |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)/C(=N/Cl)C2(CCOc4ccccc4C2)C3)c1 |
| InChI | InChI=1S/C25H19ClN2O/c1-27-21-7-4-6-17(13-21)18-9-10-19-15-25(24(28-26)22(19)14-18)11-12-29-23-8-3-2-5-20(23)16-25/h2-10,13-14H,11-12,15-16H2/b28-24- |
| InChIKey | RHVDDWIGWATOMB-COOPMVRXSA-N |
| XLogP | 6.41 |
| TPSA | 25.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|