C14H21NO3S — CID 123741148
2-(1,2-dimethyl-2-sulfanylpyrrolidin-3-yl)-3,5-dimethoxyphenol (PubChem CID 123741148) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 2-(1,2-dimethyl-2-sulfanylpyrrolidin-3-yl)-3,5-dimethoxyphenol.
| Compound Name | 2-(1,2-dimethyl-2-sulfanylpyrrolidin-3-yl)-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 123741148 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-(1,2-dimethyl-2-sulfanylpyrrolidin-3-yl)-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(C2CCN(C)C2(C)S)c(OC)c1 |
| InChI | InChI=1S/C14H21NO3S/c1-14(19)10(5-6-15(14)2)13-11(16)7-9(17-3)8-12(13)18-4/h7-8,10,16,19H,5-6H2,1-4H3 |
| InChIKey | ZLTNNOUMZGITSM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|