C23H46N+ — CID 123752320
(9-butyl-5-ethyl-7,8-dimethyltridec-11-en-2-ylidene)-dimethylazanium (PubChem CID 123752320) has the molecular formula C23H46N+ and a molecular weight of 336.63 g/mol. Its IUPAC name is (9-butyl-5-ethyl-7,8-dimethyltridec-11-en-2-ylidene)-dimethylazanium.
| Compound Name | (9-butyl-5-ethyl-7,8-dimethyltridec-11-en-2-ylidene)-dimethylazanium |
|---|---|
| PubChem CID | 123752320 |
| Molecular Formula | C23H46N+ |
| Molecular Weight | 336.63 g/mol |
| Exact Mass | 336.36 |
| IUPAC Name | (9-butyl-5-ethyl-7,8-dimethyltridec-11-en-2-ylidene)-dimethylazanium |
| SMILES | CC=CCC(CCCC)C(C)C(C)CC(CC)CCC(C)=[N+](C)C |
| InChI | InChI=1S/C23H46N/c1-9-12-14-23(15-13-10-2)21(6)19(4)18-22(11-3)17-16-20(5)24(7)8/h9,12,19,21-23H,10-11,13-18H2,1-8H3/q+1 |
| InChIKey | LJGLGKROWBMIET-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.63 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|