C14H13Cl2FN2S — CID 123756402
3-[1-(2,6-dichloro-3-fluorophenyl)ethylsulfanyl]-5-methylpyridin-2-amine (PubChem CID 123756402) has the molecular formula C14H13Cl2FN2S and a molecular weight of 331.24 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethylsulfanyl]-5-methylpyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethylsulfanyl]-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 123756402 |
| Molecular Formula | C14H13Cl2FN2S |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethylsulfanyl]-5-methylpyridin-2-amine |
| SMILES | Cc1cnc(N)c(SC(C)c2c(Cl)ccc(F)c2Cl)c1 |
| InChI | InChI=1S/C14H13Cl2FN2S/c1-7-5-11(14(18)19-6-7)20-8(2)12-9(15)3-4-10(17)13(12)16/h3-6,8H,1-2H3,(H2,18,19) |
| InChIKey | ISGPXWJNBYCPFW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|