C15H23N — CID 123769378
3-(2-methylhexan-2-yl)-3a,7a-dihydro-3H-indole (PubChem CID 123769378) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 3-(2-methylhexan-2-yl)-3a,7a-dihydro-3H-indole.
| Compound Name | 3-(2-methylhexan-2-yl)-3a,7a-dihydro-3H-indole |
|---|---|
| PubChem CID | 123769378 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 3-(2-methylhexan-2-yl)-3a,7a-dihydro-3H-indole |
| SMILES | CCCCC(C)(C)C1C=NC2C=CC=CC21 |
| InChI | InChI=1S/C15H23N/c1-4-5-10-15(2,3)13-11-16-14-9-7-6-8-12(13)14/h6-9,11-14H,4-5,10H2,1-3H3 |
| InChIKey | VYNYVAVOFZGXBB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |