C17H32O4 — CID 123871607
[6-but-3-en-2-yl-3-(hydroxymethyl)-8-(2-methylbutyl)-1,5-dioxocan-3-yl]methanol (PubChem CID 123871607) has the molecular formula C17H32O4 and a molecular weight of 300.44 g/mol. Its IUPAC name is [6-but-3-en-2-yl-3-(hydroxymethyl)-8-(2-methylbutyl)-1,5-dioxocan-3-yl]methanol.
| Compound Name | [6-but-3-en-2-yl-3-(hydroxymethyl)-8-(2-methylbutyl)-1,5-dioxocan-3-yl]methanol |
|---|---|
| PubChem CID | 123871607 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | [6-but-3-en-2-yl-3-(hydroxymethyl)-8-(2-methylbutyl)-1,5-dioxocan-3-yl]methanol |
| SMILES | C=CC(C)C1CC(CC(C)CC)OCC(CO)(CO)CO1 |
| InChI | InChI=1S/C17H32O4/c1-5-13(3)7-15-8-16(14(4)6-2)21-12-17(9-18,10-19)11-20-15/h6,13-16,18-19H,2,5,7-12H2,1,3-4H3 |
| InChIKey | LTEJNBJGDPIUCR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|