C21H24N2 — CID 123873965
N,N'-bis[1-(3,5-dimethylphenyl)ethenyl]methanimidamide (PubChem CID 123873965) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is N,N'-bis[1-(3,5-dimethylphenyl)ethenyl]methanimidamide.
| Compound Name | N,N'-bis[1-(3,5-dimethylphenyl)ethenyl]methanimidamide |
|---|---|
| PubChem CID | 123873965 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N,N'-bis[1-(3,5-dimethylphenyl)ethenyl]methanimidamide |
| SMILES | C=C(/N=C/NC(=C)c1cc(C)cc(C)c1)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C21H24N2/c1-14-7-15(2)10-20(9-14)18(5)22-13-23-19(6)21-11-16(3)8-17(4)12-21/h7-13H,5-6H2,1-4H3,(H,22,23) |
| InChIKey | HUOHKWPWLSKTQF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|