C17H30ClN — CID 123892733
4-[5-chloro-3-(2-methylbutan-2-yl)hexa-2,4-dien-2-yl]-4-methylpiperidine (PubChem CID 123892733) has the molecular formula C17H30ClN and a molecular weight of 283.89 g/mol. Its IUPAC name is 4-[5-chloro-3-(2-methylbutan-2-yl)hexa-2,4-dien-2-yl]-4-methylpiperidine.
| Compound Name | 4-[5-chloro-3-(2-methylbutan-2-yl)hexa-2,4-dien-2-yl]-4-methylpiperidine |
|---|---|
| PubChem CID | 123892733 |
| Molecular Formula | C17H30ClN |
| Molecular Weight | 283.89 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 4-[5-chloro-3-(2-methylbutan-2-yl)hexa-2,4-dien-2-yl]-4-methylpiperidine |
| SMILES | CCC(C)(C)C(C=C(C)Cl)=C(C)C1(C)CCNCC1 |
| InChI | InChI=1S/C17H30ClN/c1-7-16(4,5)15(12-13(2)18)14(3)17(6)8-10-19-11-9-17/h12,19H,7-11H2,1-6H3 |
| InChIKey | FUGORGIKYCSONR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.89 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|