C23H29FO4S — CID 123902891
2-(1-adamantyl)propan-2-yl 3-(4-carbonofluoridoyloxyphenyl)sulfanylpropanoate (PubChem CID 123902891) has the molecular formula C23H29FO4S and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-(1-adamantyl)propan-2-yl 3-(4-carbonofluoridoyloxyphenyl)sulfanylpropanoate.
| Compound Name | 2-(1-adamantyl)propan-2-yl 3-(4-carbonofluoridoyloxyphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 123902891 |
| Molecular Formula | C23H29FO4S |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-(1-adamantyl)propan-2-yl 3-(4-carbonofluoridoyloxyphenyl)sulfanylpropanoate |
| SMILES | CC(C)(OC(=O)CCSc1ccc(OC(=O)F)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H29FO4S/c1-22(2,23-12-15-9-16(13-23)11-17(10-15)14-23)28-20(25)7-8-29-19-5-3-18(4-6-19)27-21(24)26/h3-6,15-17H,7-14H2,1-2H3 |
| InChIKey | NLCUKZKPMWEAFS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|