C23H30NO2P — CID 123930266
[3-aminopropyl-(2,4,6-trimethylbenzoyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 123930266) has the molecular formula C23H30NO2P and a molecular weight of 383.47 g/mol. Its IUPAC name is [3-aminopropyl-(2,4,6-trimethylbenzoyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [3-aminopropyl-(2,4,6-trimethylbenzoyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 123930266 |
| Molecular Formula | C23H30NO2P |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | [3-aminopropyl-(2,4,6-trimethylbenzoyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(CCCN)C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C23H30NO2P/c1-14-10-16(3)20(17(4)11-14)22(25)27(9-7-8-24)23(26)21-18(5)12-15(2)13-19(21)6/h10-13H,7-9,24H2,1-6H3 |
| InChIKey | FUTOGZRKBJNRED-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|