C28H37O4P — CID 59218782
6-bis(2,4,6-trimethylbenzoyl)phosphanylhexyl acetate (PubChem CID 59218782) has the molecular formula C28H37O4P and a molecular weight of 468.57 g/mol. Its IUPAC name is 6-bis(2,4,6-trimethylbenzoyl)phosphanylhexyl acetate.
| Compound Name | 6-bis(2,4,6-trimethylbenzoyl)phosphanylhexyl acetate |
|---|---|
| PubChem CID | 59218782 |
| Molecular Formula | C28H37O4P |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 6-bis(2,4,6-trimethylbenzoyl)phosphanylhexyl acetate |
| SMILES | CC(=O)OCCCCCCP(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C28H37O4P/c1-18-14-20(3)25(21(4)15-18)27(30)33(13-11-9-8-10-12-32-24(7)29)28(31)26-22(5)16-19(2)17-23(26)6/h14-17H,8-13H2,1-7H3 |
| InChIKey | LQZPWVUDBXQHKP-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|