C18H20N4O2S2 — CID 124577198
(2Z,4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[(5-piperidin-1-ylfuran-2-yl)methylidene]thiolan-3-one (PubChem CID 124577198) has the molecular formula C18H20N4O2S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is (2Z,4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[(5-piperidin-1-ylfuran-2-yl)methylidene]thiolan-3-one.
| Compound Name | (2Z,4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[(5-piperidin-1-ylfuran-2-yl)methylidene]thiolan-3-one |
|---|---|
| PubChem CID | 124577198 |
| Molecular Formula | C18H20N4O2S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (2Z,4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[(5-piperidin-1-ylfuran-2-yl)methylidene]thiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(N3CCCCC3)o2)C(=O)[C@@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C18H20N4O2S2/c1-2-13-20-21-18(26-13)15-16(23)12(25-17(15)19)10-11-6-7-14(24-11)22-8-4-3-5-9-22/h6-7,10,15,19H,2-5,8-9H2,1H3/b12-10-,19-17-/t15-/m0/s1 |
| InChIKey | JTTLQUCQNBRYMZ-MISMWYBQSA-N |
| XLogP | 4.10 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|