C24H29NO6 — CID 126481105
[5-amino-6-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]methyl 2-oxopropanoate (PubChem CID 126481105) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is [5-amino-6-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]methyl 2-oxopropanoate.
| Compound Name | [5-amino-6-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]methyl 2-oxopropanoate |
|---|---|
| PubChem CID | 126481105 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | [5-amino-6-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]methyl 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OCC1OC(C)C(N)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C24H29NO6/c1-16(26)24(27)30-15-20-22(28-13-18-9-5-3-6-10-18)23(21(25)17(2)31-20)29-14-19-11-7-4-8-12-19/h3-12,17,20-23H,13-15,25H2,1-2H3 |
| InChIKey | HCIQNPRJCXFQQD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|