C18H29O4P2S3+ — CID 126536423
2-[[2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)sulfanylmethyl]phenyl]methylsulfanyl]-5,5-dimethyl-2-sulfanyl-1,3,2-dioxaphosphinan-2-ium (PubChem CID 126536423) has the molecular formula C18H29O4P2S3+ and a molecular weight of 467.58 g/mol. Its IUPAC name is 2-[[2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)sulfanylmethyl]phenyl]methylsulfanyl]-5,5-dimethyl-2-sulfanyl-1,3,2-dioxaphosphinan-2-ium.
| Compound Name | 2-[[2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)sulfanylmethyl]phenyl]methylsulfanyl]-5,5-dimethyl-2-sulfanyl-1,3,2-dioxaphosphinan-2-ium |
|---|---|
| PubChem CID | 126536423 |
| Molecular Formula | C18H29O4P2S3+ |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 2-[[2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)sulfanylmethyl]phenyl]methylsulfanyl]-5,5-dimethyl-2-sulfanyl-1,3,2-dioxaphosphinan-2-ium |
| SMILES | CC1(C)COP(SCc2ccccc2CS[P+]2(S)OCC(C)(C)CO2)OC1 |
| InChI | InChI=1S/C18H29O4P2S3/c1-17(2)11-19-23(20-12-17)26-9-15-7-5-6-8-16(15)10-27-24(25)21-13-18(3,4)14-22-24/h5-8,25H,9-14H2,1-4H3/q+1 |
| InChIKey | CKXIBMXNZKVASN-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|