C9H8CaO6S2 — CID 126569049
calcium 3-prop-1-en-2-ylbenzene-1,2-disulfonate (PubChem CID 126569049) has the molecular formula C9H8CaO6S2 and a molecular weight of 316.37 g/mol. Its IUPAC name is calcium 3-prop-1-en-2-ylbenzene-1,2-disulfonate.
| Compound Name | calcium 3-prop-1-en-2-ylbenzene-1,2-disulfonate |
|---|---|
| PubChem CID | 126569049 |
| Molecular Formula | C9H8CaO6S2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 315.94 |
| IUPAC Name | calcium 3-prop-1-en-2-ylbenzene-1,2-disulfonate |
| SMILES | C=C(C)c1cccc(S(=O)(=O)[O-])c1S(=O)(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C9H10O6S2.Ca/c1-6(2)7-4-3-5-8(16(10,11)12)9(7)17(13,14)15;/h3-5H,1H2,2H3,(H,10,11,12)(H,13,14,15);/q;+2/p-2 |
| InChIKey | ZSFMHBQDDYXGOH-UHFFFAOYSA-L |
| XLogP | 0.15 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|