C14H11F13 — CID 126572586
2-ethyl-1,4,4,5,6,6,7,8,8,9,9,10,10-tridecafluoro-2,3-dimethyladamantane (PubChem CID 126572586) has the molecular formula C14H11F13 and a molecular weight of 426.22 g/mol. Its IUPAC name is 2-ethyl-1,4,4,5,6,6,7,8,8,9,9,10,10-tridecafluoro-2,3-dimethyladamantane.
| Compound Name | 2-ethyl-1,4,4,5,6,6,7,8,8,9,9,10,10-tridecafluoro-2,3-dimethyladamantane |
|---|---|
| PubChem CID | 126572586 |
| Molecular Formula | C14H11F13 |
| Molecular Weight | 426.22 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 2-ethyl-1,4,4,5,6,6,7,8,8,9,9,10,10-tridecafluoro-2,3-dimethyladamantane |
| SMILES | CCC1(C)C2(C)C(F)(F)C3(F)C(F)(F)C(F)(C2(F)F)C(F)(F)C1(F)C3(F)F |
| InChI | InChI=1S/C14H11F13/c1-4-5(2)6(3)10(18,19)8(16)12(22,23)7(5,15)13(24,25)9(17,11(6,20)21)14(8,26)27/h4H2,1-3H3 |
| InChIKey | BNNJRJSYWDOZTC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.22 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |