C17H21N4O7P — CID 126608620
propan-2-yl 2-[[[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]oxy-phenoxyphosphanyl]amino]acetate (PubChem CID 126608620) has the molecular formula C17H21N4O7P and a molecular weight of 424.35 g/mol. Its IUPAC name is propan-2-yl 2-[[[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]oxy-phenoxyphosphanyl]amino]acetate.
| Compound Name | propan-2-yl 2-[[[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]oxy-phenoxyphosphanyl]amino]acetate |
|---|---|
| PubChem CID | 126608620 |
| Molecular Formula | C17H21N4O7P |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | propan-2-yl 2-[[[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]oxy-phenoxyphosphanyl]amino]acetate |
| SMILES | CC(C)OC(=O)CNP(ON=C1C(=O)N(C)C(=O)N(C)C1=O)Oc1ccccc1 |
| InChI | InChI=1S/C17H21N4O7P/c1-11(2)26-13(22)10-18-29(27-12-8-6-5-7-9-12)28-19-14-15(23)20(3)17(25)21(4)16(14)24/h5-9,11,18H,10H2,1-4H3 |
| InChIKey | UTRXNAMQOCZXPM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_sixes(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|