C33H32N2O5 — CID 126636013
N-[2-[4-[(1E,6E)-7-[4-[2-(methylamino)ethoxy]naphthalen-1-yl]-3,5-dioxohepta-1,6-dienyl]naphthalen-1-yl]oxyethyl]formamide (PubChem CID 126636013) has the molecular formula C33H32N2O5 and a molecular weight of 536.63 g/mol. Its IUPAC name is N-[2-[4-[(1E,6E)-7-[4-[2-(methylamino)ethoxy]naphthalen-1-yl]-3,5-dioxohepta-1,6-dienyl]naphthalen-1-yl]oxyethyl]formamide.
| Compound Name | N-[2-[4-[(1E,6E)-7-[4-[2-(methylamino)ethoxy]naphthalen-1-yl]-3,5-dioxohepta-1,6-dienyl]naphthalen-1-yl]oxyethyl]formamide |
|---|---|
| PubChem CID | 126636013 |
| Molecular Formula | C33H32N2O5 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | N-[2-[4-[(1E,6E)-7-[4-[2-(methylamino)ethoxy]naphthalen-1-yl]-3,5-dioxohepta-1,6-dienyl]naphthalen-1-yl]oxyethyl]formamide |
| SMILES | CNCCOc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OCCNC=O)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C33H32N2O5/c1-34-18-20-39-32-16-12-24(28-6-2-4-8-30(28)32)10-14-26(37)22-27(38)15-11-25-13-17-33(40-21-19-35-23-36)31-9-5-3-7-29(25)31/h2-17,23,34H,18-22H2,1H3,(H,35,36)/b14-10+,15-11+ |
| InChIKey | IXVLIGOPEFJXRR-WFYKWJGLSA-N |
| XLogP | 4.97 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|