C33H52N2O4 — CID 126647961
2-[(4E,8E)-11-[(2R)-6-hydroxy-2,8-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol (PubChem CID 126647961) has the molecular formula C33H52N2O4 and a molecular weight of 540.79 g/mol. Its IUPAC name is 2-[(4E,8E)-11-[(2R)-6-hydroxy-2,8-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol.
| Compound Name | 2-[(4E,8E)-11-[(2R)-6-hydroxy-2,8-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol |
|---|---|
| PubChem CID | 126647961 |
| Molecular Formula | C33H52N2O4 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.39 |
| IUPAC Name | 2-[(4E,8E)-11-[(2R)-6-hydroxy-2,8-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol |
| SMILES | C/C(=C\CC/C(C)=C/CC[C@]1(C)CCc2c(CN3CCN(C)CC3)c(O)cc(C)c2O1)CCC=C(CO)CO |
| InChI | InChI=1S/C33H52N2O4/c1-25(11-7-13-28(23-36)24-37)9-6-10-26(2)12-8-15-33(4)16-14-29-30(22-35-19-17-34(5)18-20-35)31(38)21-27(3)32(29)39-33/h9,12-13,21,36-38H,6-8,10-11,14-20,22-24H2,1-5H3/b25-9+,26-12+/t33-/m1/s1 |
| InChIKey | YKCSJZHMYAXTKO-ADNGQAMHSA-N |
| XLogP | 5.68 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|