C34H53NO3 — CID 71571102
5-[(8R)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazin-2-yl]pentan-1-ol (PubChem CID 71571102) has the molecular formula C34H53NO3 and a molecular weight of 523.80 g/mol. Its IUPAC name is 5-[(8R)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazin-2-yl]pentan-1-ol.
| Compound Name | 5-[(8R)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazin-2-yl]pentan-1-ol |
|---|---|
| PubChem CID | 71571102 |
| Molecular Formula | C34H53NO3 |
| Molecular Weight | 523.80 g/mol |
| Exact Mass | 523.40 |
| IUPAC Name | 5-[(8R)-6,8-dimethyl-8-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3,9,10-tetrahydropyrano[3,2-f][1,3]benzoxazin-2-yl]pentan-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2c3c(cc(C)c2O1)OCN(CCCCCO)C3 |
| InChI | InChI=1S/C34H53NO3/c1-26(2)13-10-14-27(3)15-11-16-28(4)17-12-19-34(6)20-18-30-31-24-35(21-8-7-9-22-36)25-37-32(31)23-29(5)33(30)38-34/h13,15,17,23,36H,7-12,14,16,18-22,24-25H2,1-6H3/b27-15+,28-17+/t34-/m1/s1 |
| InChIKey | FAYFHHCERYIZJK-YEEUPQDASA-N |
| XLogP | 8.59 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.80 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|