C28H15F9O4S — CID 126650304
(2,3,4,5,6-pentafluorophenyl) (4R)-4-[2-(4-fluorophenyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate (PubChem CID 126650304) has the molecular formula C28H15F9O4S and a molecular weight of 618.47 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (4R)-4-[2-(4-fluorophenyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (4R)-4-[2-(4-fluorophenyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate |
|---|---|
| PubChem CID | 126650304 |
| Molecular Formula | C28H15F9O4S |
| Molecular Weight | 618.47 g/mol |
| Exact Mass | 618.05 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (4R)-4-[2-(4-fluorophenyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate |
| SMILES | O=S(=O)(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc2c(c1)OCC[C@@H]2c1ccc(C(F)(F)F)cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H15F9O4S/c29-15-4-1-13(2-5-15)20-11-14(28(35,36)37)3-7-17(20)18-9-10-40-21-12-16(6-8-19(18)21)42(38,39)41-27-25(33)23(31)22(30)24(32)26(27)34/h1-8,11-12,18H,9-10H2/t18-/m1/s1 |
| InChIKey | XQGVYHAXEYSFCN-GOSISDBHSA-N |
| XLogP | 7.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.47 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|