C14H12IN3O5 — CID 126655666
[(3S,4S)-4-(3-iodopyrazol-1-yl)oxolan-3-yl] 4-nitrobenzoate (PubChem CID 126655666) has the molecular formula C14H12IN3O5 and a molecular weight of 429.17 g/mol. Its IUPAC name is [(3S,4S)-4-(3-iodopyrazol-1-yl)oxolan-3-yl] 4-nitrobenzoate.
| Compound Name | [(3S,4S)-4-(3-iodopyrazol-1-yl)oxolan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126655666 |
| Molecular Formula | C14H12IN3O5 |
| Molecular Weight | 429.17 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | [(3S,4S)-4-(3-iodopyrazol-1-yl)oxolan-3-yl] 4-nitrobenzoate |
| SMILES | O=C(O[C@@H]1COC[C@@H]1n1ccc(I)n1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H12IN3O5/c15-13-5-6-17(16-13)11-7-22-8-12(11)23-14(19)9-1-3-10(4-2-9)18(20)21/h1-6,11-12H,7-8H2/t11-,12+/m0/s1 |
| InChIKey | MEEGHZVFIZRBAA-NWDGAFQWSA-N |
| XLogP | 2.19 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.17 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|