C12H15ClN2O4 — CID 126759252
(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-3-methyloxolane-2-carbaldehyde (PubChem CID 126759252) has the molecular formula C12H15ClN2O4 and a molecular weight of 286.72 g/mol. Its IUPAC name is (2R,3R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-3-methyloxolane-2-carbaldehyde.
| Compound Name | (2R,3R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-3-methyloxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 126759252 |
| Molecular Formula | C12H15ClN2O4 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (2R,3R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-3-methyloxolane-2-carbaldehyde |
| SMILES | CC[C@@]1(C=O)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](Cl)[C@@H]1C |
| InChI | InChI=1S/C12H15ClN2O4/c1-3-12(6-16)7(2)9(13)10(19-12)15-5-4-8(17)14-11(15)18/h4-7,9-10H,3H2,1-2H3,(H,14,17,18)/t7-,9+,10+,12-/m0/s1 |
| InChIKey | ZFTCURGPWDWLLK-UYAIAHHASA-N |
| XLogP | 0.66 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|