C16H29N3O5 — CID 126819677
tert-butyl 3-[(2-carbamoylmorpholin-4-yl)methyl]-3-hydroxypiperidine-1-carboxylate (PubChem CID 126819677) has the molecular formula C16H29N3O5 and a molecular weight of 343.42 g/mol. Its IUPAC name is tert-butyl 3-[(2-carbamoylmorpholin-4-yl)methyl]-3-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-carbamoylmorpholin-4-yl)methyl]-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 126819677 |
| Molecular Formula | C16H29N3O5 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | tert-butyl 3-[(2-carbamoylmorpholin-4-yl)methyl]-3-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(O)(CN2CCOC(C(N)=O)C2)C1 |
| InChI | InChI=1S/C16H29N3O5/c1-15(2,3)24-14(21)19-6-4-5-16(22,11-19)10-18-7-8-23-12(9-18)13(17)20/h12,22H,4-11H2,1-3H3,(H2,17,20) |
| InChIKey | LODIQWSDSMAECW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |