C21H21BrN2P+ — CID 126959573
4,5-dihydro-1H-pyrazol-3-yl(triphenyl)phosphanium;hydrobromide (PubChem CID 126959573) has the molecular formula C21H21BrN2P+ and a molecular weight of 412.29 g/mol. Its IUPAC name is 4,5-dihydro-1H-pyrazol-3-yl(triphenyl)phosphanium;hydrobromide.
| Compound Name | 4,5-dihydro-1H-pyrazol-3-yl(triphenyl)phosphanium;hydrobromide |
|---|---|
| PubChem CID | 126959573 |
| Molecular Formula | C21H21BrN2P+ |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 4,5-dihydro-1H-pyrazol-3-yl(triphenyl)phosphanium;hydrobromide |
| SMILES | Br.c1ccc([P+](C2=NNCC2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2P.BrH/c1-4-10-18(11-5-1)24(21-16-17-22-23-21,19-12-6-2-7-13-19)20-14-8-3-9-15-20;/h1-15,22H,16-17H2;1H/q+1; |
| InChIKey | KFAVAGSJNZJMEZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|