C12H16N2 — CID 59363895
1-propan-2-yl-4,5-dihydro-3H-2,3-benzodiazepine (PubChem CID 59363895) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-propan-2-yl-4,5-dihydro-3H-2,3-benzodiazepine.
| Compound Name | 1-propan-2-yl-4,5-dihydro-3H-2,3-benzodiazepine |
|---|---|
| PubChem CID | 59363895 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-propan-2-yl-4,5-dihydro-3H-2,3-benzodiazepine |
| SMILES | CC(C)C1=NNCCc2ccccc21 |
| InChI | InChI=1S/C12H16N2/c1-9(2)12-11-6-4-3-5-10(11)7-8-13-14-12/h3-6,9,13H,7-8H2,1-2H3 |
| InChIKey | QJGOZLOCBZYPTF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |