C21H21N7 — CID 127041163
2-[4-[[(8-methyl-2-pyridin-3-ylimidazo[1,2-a]pyridin-3-yl)amino]methyl]phenyl]guanidine (PubChem CID 127041163) has the molecular formula C21H21N7 and a molecular weight of 371.45 g/mol. Its IUPAC name is 2-[4-[[(8-methyl-2-pyridin-3-ylimidazo[1,2-a]pyridin-3-yl)amino]methyl]phenyl]guanidine.
| Compound Name | 2-[4-[[(8-methyl-2-pyridin-3-ylimidazo[1,2-a]pyridin-3-yl)amino]methyl]phenyl]guanidine |
|---|---|
| PubChem CID | 127041163 |
| Molecular Formula | C21H21N7 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 2-[4-[[(8-methyl-2-pyridin-3-ylimidazo[1,2-a]pyridin-3-yl)amino]methyl]phenyl]guanidine |
| SMILES | Cc1cccn2c(NCc3ccc(N=C(N)N)cc3)c(-c3cccnc3)nc12 |
| InChI | InChI=1S/C21H21N7/c1-14-4-3-11-28-19(14)27-18(16-5-2-10-24-13-16)20(28)25-12-15-6-8-17(9-7-15)26-21(22)23/h2-11,13,25H,12H2,1H3,(H4,22,23,26) |
| InChIKey | VEEFOEDPARCWAI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|