C37H31N3O6 — CID 127047013
4-[3-[4-[[2-methoxy-4-[(1E,4E)-5-naphthalen-1-yl-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]propoxy]chromen-2-one (PubChem CID 127047013) has the molecular formula C37H31N3O6 and a molecular weight of 613.67 g/mol. Its IUPAC name is 4-[3-[4-[[2-methoxy-4-[(1E,4E)-5-naphthalen-1-yl-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]propoxy]chromen-2-one.
| Compound Name | 4-[3-[4-[[2-methoxy-4-[(1E,4E)-5-naphthalen-1-yl-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]propoxy]chromen-2-one |
|---|---|
| PubChem CID | 127047013 |
| Molecular Formula | C37H31N3O6 |
| Molecular Weight | 613.67 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | 4-[3-[4-[[2-methoxy-4-[(1E,4E)-5-naphthalen-1-yl-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]propoxy]chromen-2-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2cccc3ccccc23)ccc1OCc1cn(CCCOc2cc(=O)oc3ccccc23)nn1 |
| InChI | InChI=1S/C37H31N3O6/c1-43-36-22-26(14-17-30(41)18-16-28-10-6-9-27-8-2-3-11-31(27)28)15-19-34(36)45-25-29-24-40(39-38-29)20-7-21-44-35-23-37(42)46-33-13-5-4-12-32(33)35/h2-6,8-19,22-24H,7,20-21,25H2,1H3/b17-14+,18-16+ |
| InChIKey | BMTGNVMVCRLULJ-MLHBKYQTSA-N |
| XLogP | 6.89 |
| TPSA | 105.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.67 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|