C36H29N3O6 — CID 127047816
4-[2-[4-[[2-methoxy-4-[(1E,4E)-5-naphthalen-1-yl-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one (PubChem CID 127047816) has the molecular formula C36H29N3O6 and a molecular weight of 599.64 g/mol. Its IUPAC name is 4-[2-[4-[[2-methoxy-4-[(1E,4E)-5-naphthalen-1-yl-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one.
| Compound Name | 4-[2-[4-[[2-methoxy-4-[(1E,4E)-5-naphthalen-1-yl-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one |
|---|---|
| PubChem CID | 127047816 |
| Molecular Formula | C36H29N3O6 |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | 4-[2-[4-[[2-methoxy-4-[(1E,4E)-5-naphthalen-1-yl-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2cccc3ccccc23)ccc1OCc1cn(CCOc2cc(=O)oc3ccccc23)nn1 |
| InChI | InChI=1S/C36H29N3O6/c1-42-35-21-25(13-16-29(40)17-15-27-9-6-8-26-7-2-3-10-30(26)27)14-18-33(35)44-24-28-23-39(38-37-28)19-20-43-34-22-36(41)45-32-12-5-4-11-31(32)34/h2-18,21-23H,19-20,24H2,1H3/b16-13+,17-15+ |
| InChIKey | RBOSXOUBHNIQND-NLEMEUKFSA-N |
| XLogP | 6.50 |
| TPSA | 105.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|