C24H12Cl2O5 — CID 127050396
3,7-bis(3-chlorophenyl)-5-hydroxypyrano[3,2-g]chromene-4,6-dione (PubChem CID 127050396) has the molecular formula C24H12Cl2O5 and a molecular weight of 451.26 g/mol. Its IUPAC name is 3,7-bis(3-chlorophenyl)-5-hydroxypyrano[3,2-g]chromene-4,6-dione.
| Compound Name | 3,7-bis(3-chlorophenyl)-5-hydroxypyrano[3,2-g]chromene-4,6-dione |
|---|---|
| PubChem CID | 127050396 |
| Molecular Formula | C24H12Cl2O5 |
| Molecular Weight | 451.26 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | 3,7-bis(3-chlorophenyl)-5-hydroxypyrano[3,2-g]chromene-4,6-dione |
| SMILES | O=c1c(-c2cccc(Cl)c2)coc2cc3occ(-c4cccc(Cl)c4)c(=O)c3c(O)c12 |
| InChI | InChI=1S/C24H12Cl2O5/c25-14-5-1-3-12(7-14)16-10-30-18-9-19-21(24(29)20(18)22(16)27)23(28)17(11-31-19)13-4-2-6-15(26)8-13/h1-11,29H |
| InChIKey | GFYHNMRHAMVYED-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.26 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|