C20H21N5O2 — CID 129014626
3-imidazo[1,2-b]pyridazin-2-yl-7-(4-methylpiperazin-1-yl)-2H-chromen-2-ol (PubChem CID 129014626) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-imidazo[1,2-b]pyridazin-2-yl-7-(4-methylpiperazin-1-yl)-2H-chromen-2-ol.
| Compound Name | 3-imidazo[1,2-b]pyridazin-2-yl-7-(4-methylpiperazin-1-yl)-2H-chromen-2-ol |
|---|---|
| PubChem CID | 129014626 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-imidazo[1,2-b]pyridazin-2-yl-7-(4-methylpiperazin-1-yl)-2H-chromen-2-ol |
| SMILES | CN1CCN(c2ccc3c(c2)OC(O)C(c2cn4ncccc4n2)=C3)CC1 |
| InChI | InChI=1S/C20H21N5O2/c1-23-7-9-24(10-8-23)15-5-4-14-11-16(20(26)27-18(14)12-15)17-13-25-19(22-17)3-2-6-21-25/h2-6,11-13,20,26H,7-10H2,1H3 |
| InChIKey | LELJZHMJPMPTIH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|