C25H25NO5S — CID 129115704
3-hydroxy-6-(2-methylsulfonylbutan-2-yl)-2-[[4-(2-phenylethynyl)anilino]methyl]pyran-4-one (PubChem CID 129115704) has the molecular formula C25H25NO5S and a molecular weight of 451.54 g/mol. Its IUPAC name is 3-hydroxy-6-(2-methylsulfonylbutan-2-yl)-2-[[4-(2-phenylethynyl)anilino]methyl]pyran-4-one.
| Compound Name | 3-hydroxy-6-(2-methylsulfonylbutan-2-yl)-2-[[4-(2-phenylethynyl)anilino]methyl]pyran-4-one |
|---|---|
| PubChem CID | 129115704 |
| Molecular Formula | C25H25NO5S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 3-hydroxy-6-(2-methylsulfonylbutan-2-yl)-2-[[4-(2-phenylethynyl)anilino]methyl]pyran-4-one |
| SMILES | CCC(C)(c1cc(=O)c(O)c(CNc2ccc(C#Cc3ccccc3)cc2)o1)S(C)(=O)=O |
| InChI | InChI=1S/C25H25NO5S/c1-4-25(2,32(3,29)30)23-16-21(27)24(28)22(31-23)17-26-20-14-12-19(13-15-20)11-10-18-8-6-5-7-9-18/h5-9,12-16,26,28H,4,17H2,1-3H3 |
| InChIKey | AQUVLENGDHLECP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|