C20H23NO8S — CID 129273279
(E,3E)-4-hydroxy-3-(1-hydroxy-2-iminoethylidene)-1-(7-methoxy-1',1'-dioxospiro[1,3-benzodioxole-2,4'-thiane]-4-yl)hex-4-en-1-one (PubChem CID 129273279) has the molecular formula C20H23NO8S and a molecular weight of 437.47 g/mol. Its IUPAC name is (E,3E)-4-hydroxy-3-(1-hydroxy-2-iminoethylidene)-1-(7-methoxy-1',1'-dioxospiro[1,3-benzodioxole-2,4'-thiane]-4-yl)hex-4-en-1-one.
| Compound Name | (E,3E)-4-hydroxy-3-(1-hydroxy-2-iminoethylidene)-1-(7-methoxy-1',1'-dioxospiro[1,3-benzodioxole-2,4'-thiane]-4-yl)hex-4-en-1-one |
|---|---|
| PubChem CID | 129273279 |
| Molecular Formula | C20H23NO8S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | (E,3E)-4-hydroxy-3-(1-hydroxy-2-iminoethylidene)-1-(7-methoxy-1',1'-dioxospiro[1,3-benzodioxole-2,4'-thiane]-4-yl)hex-4-en-1-one |
| SMILES | [H]/N=C/C(O)=C(CC(=O)c1ccc(OC)c2c1OC1(CCS(=O)(=O)CC1)O2)\C(O)=C/C |
| InChI | InChI=1S/C20H23NO8S/c1-3-14(22)13(16(24)11-21)10-15(23)12-4-5-17(27-2)19-18(12)28-20(29-19)6-8-30(25,26)9-7-20/h3-5,11,21-22,24H,6-10H2,1-2H3/b14-3+,16-13+,21-11+ |
| InChIKey | ZPCSVIPXJZDBHO-XCCSPUORSA-N |
| XLogP | 2.87 |
| TPSA | 143.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|