C13H21F2N — CID 129304305
2-[4-[(3,3-difluorocyclobutyl)methyl]-2-methylcyclopent-3-en-1-yl]ethanamine (PubChem CID 129304305) has the molecular formula C13H21F2N and a molecular weight of 229.31 g/mol. Its IUPAC name is 2-[4-[(3,3-difluorocyclobutyl)methyl]-2-methylcyclopent-3-en-1-yl]ethanamine.
| Compound Name | 2-[4-[(3,3-difluorocyclobutyl)methyl]-2-methylcyclopent-3-en-1-yl]ethanamine |
|---|---|
| PubChem CID | 129304305 |
| Molecular Formula | C13H21F2N |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 2-[4-[(3,3-difluorocyclobutyl)methyl]-2-methylcyclopent-3-en-1-yl]ethanamine |
| SMILES | CC1C=C(CC2CC(F)(F)C2)CC1CCN |
| InChI | InChI=1S/C13H21F2N/c1-9-4-10(6-12(9)2-3-16)5-11-7-13(14,15)8-11/h4,9,11-12H,2-3,5-8,16H2,1H3 |
| InChIKey | RSZPXQKWAANFGY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|