C7H5ClOS — CID 129304896
6-chloro-3H-2,1-benzoxathiole (PubChem CID 129304896) has the molecular formula C7H5ClOS and a molecular weight of 172.64 g/mol. Its IUPAC name is 6-chloro-3H-2,1-benzoxathiole.
| Compound Name | 6-chloro-3H-2,1-benzoxathiole |
|---|---|
| PubChem CID | 129304896 |
| Molecular Formula | C7H5ClOS |
| Molecular Weight | 172.64 g/mol |
| Exact Mass | 171.97 |
| IUPAC Name | 6-chloro-3H-2,1-benzoxathiole |
| SMILES | Clc1ccc2c(c1)SOC2 |
| InChI | InChI=1S/C7H5ClOS/c8-6-2-1-5-4-9-10-7(5)3-6/h1-3H,4H2 |
| InChIKey | UZXZYQDUFHHRTE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.64 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|