C32H39N2O14S4+ — CID 129313966
(2E)-2-[(2E,4E)-5-[3,3-dimethyl-5,7-disulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1-(3-sulfopropyl)indole-4-carboxylic acid (PubChem CID 129313966) has the molecular formula C32H39N2O14S4+ and a molecular weight of 803.93 g/mol. Its IUPAC name is (2E)-2-[(2E,4E)-5-[3,3-dimethyl-5,7-disulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1-(3-sulfopropyl)indole-4-carboxylic acid.
| Compound Name | (2E)-2-[(2E,4E)-5-[3,3-dimethyl-5,7-disulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1-(3-sulfopropyl)indole-4-carboxylic acid |
|---|---|
| PubChem CID | 129313966 |
| Molecular Formula | C32H39N2O14S4+ |
| Molecular Weight | 803.93 g/mol |
| Exact Mass | 803.13 |
| IUPAC Name | (2E)-2-[(2E,4E)-5-[3,3-dimethyl-5,7-disulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1-(3-sulfopropyl)indole-4-carboxylic acid |
| SMILES | CC1(C)C(/C=C/C=C/C=C2/N(CCCS(=O)(=O)O)c3cccc(C(=O)O)c3C2(C)C)=[N+](CCCS(=O)(=O)O)c2c1cc(S(=O)(=O)O)cc2S(=O)(=O)O |
| InChI | InChI=1S/C32H38N2O14S4/c1-31(2)23-19-21(51(43,44)45)20-25(52(46,47)48)29(23)34(16-10-18-50(40,41)42)26(31)13-6-5-7-14-27-32(3,4)28-22(30(35)36)11-8-12-24(28)33(27)15-9-17-49(37,38)39/h5-8,11-14,19-20H,9-10,15-18H2,1-4H3,(H4-,35,36,37,38,39,40,41,42,43,44,45,46,47,48)/p+1 |
| InChIKey | BZRODKDXVGLKJI-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 261.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.93 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|