C13H17FO3 — CID 129389369
(2R)-2-[(4-fluorophenoxy)methyl]-4-[(2S)-oxiran-2-yl]butan-1-ol (PubChem CID 129389369) has the molecular formula C13H17FO3 and a molecular weight of 240.27 g/mol. Its IUPAC name is (2R)-2-[(4-fluorophenoxy)methyl]-4-[(2S)-oxiran-2-yl]butan-1-ol.
| Compound Name | (2R)-2-[(4-fluorophenoxy)methyl]-4-[(2S)-oxiran-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 129389369 |
| Molecular Formula | C13H17FO3 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (2R)-2-[(4-fluorophenoxy)methyl]-4-[(2S)-oxiran-2-yl]butan-1-ol |
| SMILES | OC[C@@H](CC[C@H]1CO1)COc1ccc(F)cc1 |
| InChI | InChI=1S/C13H17FO3/c14-11-2-5-12(6-3-11)16-8-10(7-15)1-4-13-9-17-13/h2-3,5-6,10,13,15H,1,4,7-9H2/t10-,13+/m1/s1 |
| InChIKey | JFFODZPOCQTQPG-MFKMUULPSA-N |
| XLogP | 1.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|