C13H15N5 — CID 129440443
N,N-dimethyl-4-[(E)-3-(1,2,4-triazol-4-ylimino)prop-1-enyl]aniline (PubChem CID 129440443) has the molecular formula C13H15N5 and a molecular weight of 241.30 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-3-(1,2,4-triazol-4-ylimino)prop-1-enyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-3-(1,2,4-triazol-4-ylimino)prop-1-enyl]aniline |
|---|---|
| PubChem CID | 129440443 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N,N-dimethyl-4-[(E)-3-(1,2,4-triazol-4-ylimino)prop-1-enyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/C=Nn2cnnc2)cc1 |
| InChI | InChI=1S/C13H15N5/c1-17(2)13-7-5-12(6-8-13)4-3-9-16-18-10-14-15-11-18/h3-11H,1-2H3/b4-3+,16-9? |
| InChIKey | SQYQYMYBJMOGGZ-IZHGCUBQSA-N |
| XLogP | 1.89 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|