C7H5NO4 — CID 12962584
5-(furan-3-yl)-1,3-oxazolidine-2,4-dione (PubChem CID 12962584) has the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. Its IUPAC name is 5-(furan-3-yl)-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-(furan-3-yl)-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 12962584 |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 5-(furan-3-yl)-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2ccoc2)O1 |
| InChI | InChI=1S/C7H5NO4/c9-6-5(12-7(10)8-6)4-1-2-11-3-4/h1-3,5H,(H,8,9,10) |
| InChIKey | WHNCQNLFZNRFLR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |