About 4-propyl-3,4-dihydro-1H-quinazoline-2-thione
4-propyl-3,4-dihydro-1H-quinazoline-2-thione (PubChem CID 130014956) has the molecular formula C11H14N2S
and a molecular weight of 206.31 g/mol. Its IUPAC name is 4-propyl-3,4-dihydro-1H-quinazoline-2-thione.
Molecular Properties
| Compound Name | 4-propyl-3,4-dihydro-1H-quinazoline-2-thione |
| PubChem CID | 130014956 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-propyl-3,4-dihydro-1H-quinazoline-2-thione |
| SMILES | CCCC1NC(=S)Nc2ccccc21 |
| InChI | InChI=1S/C11H14N2S/c1-2-5-9-8-6-3-4-7-10(8)13-11(14)12-9/h3-4,6-7,9H,2,5H2,1H3,(H2,12,13,14) |
| InChIKey | ZEJOEEKJOGPQNE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-propyl-3,4-dihydro-1H-quinazoline-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propyl-3,4-dihydro-1H-quinazoline-2-thione?
The IUPAC name of 4-propyl-3,4-dihydro-1H-quinazoline-2-thione (CID 130014956) is 4-propyl-3,4-dihydro-1H-quinazoline-2-thione.
What is the SMILES notation for 4-propyl-3,4-dihydro-1H-quinazoline-2-thione?
The canonical SMILES for 4-propyl-3,4-dihydro-1H-quinazoline-2-thione is CCCC1NC(=S)Nc2ccccc21.
What is the InChIKey of 4-propyl-3,4-dihydro-1H-quinazoline-2-thione?
The InChIKey is ZEJOEEKJOGPQNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2S/c1-2-5-9-8-6-3-4-7-10(8)13-11(14)12-9/h3-4,6-7,9H,2,5H2,1H3,(H2,12,13,14).
What are the key properties of 4-propyl-3,4-dihydro-1H-quinazoline-2-thione?
4-propyl-3,4-dihydro-1H-quinazoline-2-thione has a molecular weight of 206.31 g/mol, XLogP of 2.83, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propyl-3,4-dihydro-1H-quinazoline-2-thione is sourced from PubChem (CID 130014956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).