C6H11NO — CID 130269457
(3Z)-4-aminohexa-1,3-dien-3-ol (PubChem CID 130269457) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is (3Z)-4-aminohexa-1,3-dien-3-ol.
| Compound Name | (3Z)-4-aminohexa-1,3-dien-3-ol |
|---|---|
| PubChem CID | 130269457 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (3Z)-4-aminohexa-1,3-dien-3-ol |
| SMILES | C=C/C(O)=C(/N)CC |
| InChI | InChI=1S/C6H11NO/c1-3-5(7)6(8)4-2/h4,8H,2-3,7H2,1H3/b6-5- |
| InChIKey | HWSWBVKFOCFBOK-WAYWQWQTSA-N |
| XLogP | 1.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|