C23H23F6N7O6 — CID 130334944
[(3aS,10aS)-2,6-diamino-10,10-dihydroxy-4-[(3-methyl-2,5-dioxopyrrolidin-1-yl)methyl]-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate (PubChem CID 130334944) has the molecular formula C23H23F6N7O6 and a molecular weight of 607.47 g/mol. Its IUPAC name is [(3aS,10aS)-2,6-diamino-10,10-dihydroxy-4-[(3-methyl-2,5-dioxopyrrolidin-1-yl)methyl]-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate.
| Compound Name | [(3aS,10aS)-2,6-diamino-10,10-dihydroxy-4-[(3-methyl-2,5-dioxopyrrolidin-1-yl)methyl]-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 130334944 |
| Molecular Formula | C23H23F6N7O6 |
| Molecular Weight | 607.47 g/mol |
| Exact Mass | 607.16 |
| IUPAC Name | [(3aS,10aS)-2,6-diamino-10,10-dihydroxy-4-[(3-methyl-2,5-dioxopyrrolidin-1-yl)methyl]-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate |
| SMILES | CC1CC(=O)N(CC2N=C(N)N3CC(OC(=O)c4cc(C(F)(F)F)ccc4C(F)(F)F)C(O)(O)[C@@]34NC(N)=N[C@@H]24)C1=O |
| InChI | InChI=1S/C23H23F6N7O6/c1-8-4-14(37)35(16(8)38)6-12-15-20(34-18(30)33-15)21(40,41)13(7-36(20)19(31)32-12)42-17(39)10-5-9(22(24,25)26)2-3-11(10)23(27,28)29/h2-3,5,8,12-13,15,40-41H,4,6-7H2,1H3,(H2,31,32)(H3,30,33,34)/t8?,12?,13?,15-,20-/m0/s1 |
| InChIKey | MXNASNCHEKINRG-CNDFZSMGSA-N |
| XLogP | -0.68 |
| TPSA | 196.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.47 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|