C13H16Cl2N3OP — CID 130391583
2,5-dichloro-N-(2-dimethylphosphorylphenyl)-1-methyl-2H-pyrimidin-4-amine (PubChem CID 130391583) has the molecular formula C13H16Cl2N3OP and a molecular weight of 332.17 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-dimethylphosphorylphenyl)-1-methyl-2H-pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-(2-dimethylphosphorylphenyl)-1-methyl-2H-pyrimidin-4-amine |
|---|---|
| PubChem CID | 130391583 |
| Molecular Formula | C13H16Cl2N3OP |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2,5-dichloro-N-(2-dimethylphosphorylphenyl)-1-methyl-2H-pyrimidin-4-amine |
| SMILES | CN1C=C(Cl)C(Nc2ccccc2P(C)(C)=O)=NC1Cl |
| InChI | InChI=1S/C13H16Cl2N3OP/c1-18-8-9(14)12(17-13(18)15)16-10-6-4-5-7-11(10)20(2,3)19/h4-8,13H,1-3H3,(H,16,17) |
| InChIKey | GKMRRSWBXARIFL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|