C9H14F3I2NO2 — CID 130427382
(3,3,4-trifluoro-1-iodooxy-4-piperidin-1-ylbutan-2-yl) hypoiodite (PubChem CID 130427382) has the molecular formula C9H14F3I2NO2 and a molecular weight of 479.02 g/mol. Its IUPAC name is (3,3,4-trifluoro-1-iodooxy-4-piperidin-1-ylbutan-2-yl) hypoiodite.
| Compound Name | (3,3,4-trifluoro-1-iodooxy-4-piperidin-1-ylbutan-2-yl) hypoiodite |
|---|---|
| PubChem CID | 130427382 |
| Molecular Formula | C9H14F3I2NO2 |
| Molecular Weight | 479.02 g/mol |
| Exact Mass | 478.91 |
| IUPAC Name | (3,3,4-trifluoro-1-iodooxy-4-piperidin-1-ylbutan-2-yl) hypoiodite |
| SMILES | FC(N1CCCCC1)C(F)(F)C(COI)OI |
| InChI | InChI=1S/C9H14F3I2NO2/c10-8(15-4-2-1-3-5-15)9(11,12)7(17-14)6-16-13/h7-8H,1-6H2 |
| InChIKey | NMTDBRIFVVPFGN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.02 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|