C10H14N5O4P — CID 130427538
[1-[(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)methyl]cyclopropyl]oxymethylphosphonic acid (PubChem CID 130427538) has the molecular formula C10H14N5O4P and a molecular weight of 299.23 g/mol. Its IUPAC name is [1-[(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)methyl]cyclopropyl]oxymethylphosphonic acid.
| Compound Name | [1-[(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)methyl]cyclopropyl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 130427538 |
| Molecular Formula | C10H14N5O4P |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | [1-[(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)methyl]cyclopropyl]oxymethylphosphonic acid |
| SMILES | Nc1ncnc2c(CC3(OCP(=O)(O)O)CC3)cnn12 |
| InChI | InChI=1S/C10H14N5O4P/c11-9-13-5-12-8-7(4-14-15(8)9)3-10(1-2-10)19-6-20(16,17)18/h4-5H,1-3,6H2,(H2,11,12,13)(H2,16,17,18) |
| InChIKey | HBEGCGHNMASHJZ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|