C10H15FN5O4P — CID 145368081
[1-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-4-fluorobutan-2-yl]oxymethylphosphonic acid (PubChem CID 145368081) has the molecular formula C10H15FN5O4P and a molecular weight of 319.23 g/mol. Its IUPAC name is [1-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-4-fluorobutan-2-yl]oxymethylphosphonic acid.
| Compound Name | [1-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-4-fluorobutan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 145368081 |
| Molecular Formula | C10H15FN5O4P |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | [1-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-4-fluorobutan-2-yl]oxymethylphosphonic acid |
| SMILES | Nc1ncnc2c(CC(CCF)OCP(=O)(O)O)cnn12 |
| InChI | InChI=1S/C10H15FN5O4P/c11-2-1-8(20-6-21(17,18)19)3-7-4-15-16-9(7)13-5-14-10(16)12/h4-5,8H,1-3,6H2,(H2,12,13,14)(H2,17,18,19) |
| InChIKey | LPIIDXQHCAWFBE-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|