About sodium 3-ethoxybenzenesulfinate
sodium 3-ethoxybenzenesulfinate (PubChem CID 130538056) has the molecular formula C8H9NaO3S
and a molecular weight of 208.21 g/mol. Its IUPAC name is sodium 3-ethoxybenzenesulfinate.
Molecular Properties
| Compound Name | sodium 3-ethoxybenzenesulfinate |
| PubChem CID | 130538056 |
| Molecular Formula | C8H9NaO3S |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | sodium 3-ethoxybenzenesulfinate |
| SMILES | CCOc1cccc(S(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C8H10O3S.Na/c1-2-11-7-4-3-5-8(6-7)12(9)10;/h3-6H,2H2,1H3,(H,9,10);/q;+1/p-1 |
| InChIKey | WAWGBRYODXOFRT-UHFFFAOYSA-M |
| XLogP | -1.67 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-ethoxybenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-ethoxybenzenesulfinate?
The IUPAC name of sodium 3-ethoxybenzenesulfinate (CID 130538056) is sodium 3-ethoxybenzenesulfinate.
What is the SMILES notation for sodium 3-ethoxybenzenesulfinate?
The canonical SMILES for sodium 3-ethoxybenzenesulfinate is CCOc1cccc(S(=O)[O-])c1.[Na+].
What is the InChIKey of sodium 3-ethoxybenzenesulfinate?
The InChIKey is WAWGBRYODXOFRT-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10O3S.Na/c1-2-11-7-4-3-5-8(6-7)12(9)10;/h3-6H,2H2,1H3,(H,9,10);/q;+1/p-1.
What are the key properties of sodium 3-ethoxybenzenesulfinate?
sodium 3-ethoxybenzenesulfinate has a molecular weight of 208.21 g/mol, XLogP of -1.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-ethoxybenzenesulfinate is sourced from PubChem (CID 130538056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).