C10H14O2 — CID 130763782
[(1S,2S,3S,5R,8R)-1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl]methanol (PubChem CID 130763782) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is [(1S,2S,3S,5R,8R)-1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl]methanol.
| Compound Name | [(1S,2S,3S,5R,8R)-1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl]methanol |
|---|---|
| PubChem CID | 130763782 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | [(1S,2S,3S,5R,8R)-1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl]methanol |
| SMILES | CO[C@@]12[C@H]3[C@@H](CO)C[C@@H]1C=C[C@H]32 |
| InChI | InChI=1S/C10H14O2/c1-12-10-7-2-3-8(10)9(10)6(4-7)5-11/h2-3,6-9,11H,4-5H2,1H3/t6-,7+,8-,9+,10+/m1/s1 |
| InChIKey | JDGBCXMLMPSABJ-KGDYZURWSA-N |
| XLogP | 0.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|