C16H12ClNOS — CID 13154638
3-(chloromethyl)-2-phenyl-5H-1,5-benzothiazepin-4-one (PubChem CID 13154638) has the molecular formula C16H12ClNOS and a molecular weight of 301.80 g/mol. Its IUPAC name is 3-(chloromethyl)-2-phenyl-5H-1,5-benzothiazepin-4-one.
| Compound Name | 3-(chloromethyl)-2-phenyl-5H-1,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 13154638 |
| Molecular Formula | C16H12ClNOS |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 3-(chloromethyl)-2-phenyl-5H-1,5-benzothiazepin-4-one |
| SMILES | O=C1Nc2ccccc2SC(c2ccccc2)=C1CCl |
| InChI | InChI=1S/C16H12ClNOS/c17-10-12-15(11-6-2-1-3-7-11)20-14-9-5-4-8-13(14)18-16(12)19/h1-9H,10H2,(H,18,19) |
| InChIKey | BQXXILXRLUTQEQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|