C7H3F3N2O3 — CID 131614321
5-hydroxy-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carbonitrile (PubChem CID 131614321) has the molecular formula C7H3F3N2O3 and a molecular weight of 220.11 g/mol. Its IUPAC name is 5-hydroxy-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carbonitrile.
| Compound Name | 5-hydroxy-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 131614321 |
| Molecular Formula | C7H3F3N2O3 |
| Molecular Weight | 220.11 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 5-hydroxy-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carbonitrile |
| SMILES | N#Cc1c(O)c[nH]c(=O)c1OC(F)(F)F |
| InChI | InChI=1S/C7H3F3N2O3/c8-7(9,10)15-5-3(1-11)4(13)2-12-6(5)14/h2,13H,(H,12,14) |
| InChIKey | ZCEQSRIROZISEF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.11 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |